C20H32N2O18S2 — CID 53380619
3-[[2-carboxy-2-[(3,4,5,6-tetrahydroxyoxan-2-yl)methoxycarbonylamino]ethyl]disulfanyl]-2-[(3,4,5,6-tetrahydroxyoxan-2-yl)methoxycarbonylamino]propanoic acid (PubChem CID 53380619) has the molecular formula C20H32N2O18S2 and a molecular weight of 652.61 g/mol. Its IUPAC name is 3-[[2-carboxy-2-[(3,4,5,6-tetrahydroxyoxan-2-yl)methoxycarbonylamino]ethyl]disulfanyl]-2-[(3,4,5,6-tetrahydroxyoxan-2-yl)methoxycarbonylamino]propanoic acid.
| Compound Name | 3-[[2-carboxy-2-[(3,4,5,6-tetrahydroxyoxan-2-yl)methoxycarbonylamino]ethyl]disulfanyl]-2-[(3,4,5,6-tetrahydroxyoxan-2-yl)methoxycarbonylamino]propanoic acid |
|---|---|
| PubChem CID | 53380619 |
| Molecular Formula | C20H32N2O18S2 |
| Molecular Weight | 652.61 g/mol |
| Exact Mass | 652.11 |
| IUPAC Name | 3-[[2-carboxy-2-[(3,4,5,6-tetrahydroxyoxan-2-yl)methoxycarbonylamino]ethyl]disulfanyl]-2-[(3,4,5,6-tetrahydroxyoxan-2-yl)methoxycarbonylamino]propanoic acid |
| SMILES | O=C(NC(CSSCC(NC(=O)OCC1OC(O)C(O)C(O)C1O)C(=O)O)C(=O)O)OCC1OC(O)C(O)C(O)C1O |
| InChI | InChI=1S/C20H32N2O18S2/c23-9-7(39-17(33)13(27)11(9)25)1-37-19(35)21-5(15(29)30)3-41-42-4-6(16(31)32)22-20(36)38-2-8-10(24)12(26)14(28)18(34)40-8/h5-14,17-18,23-28,33-34H,1-4H2,(H,21,35)(H,22,36)(H,29,30)(H,31,32) |
| InChIKey | BVOKQYQVPKUVMR-UHFFFAOYSA-N |
| XLogP | -5.67 |
| TPSA | 331.56 Ų |
| H-Bond Donors | 12 |
| H-Bond Acceptors | 18 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 42 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 652.61 |
| LogP ≤ 5 | -5.67 |
| H-Bond Donors ≤ 5 | 12 |
| H-Bond Acceptors ≤ 10 | 18 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|