C24H30N2O10 — CID 101239089
[(2R,3S,4S,5R)-3,4,5,6-tetrahydroxyoxan-2-yl]methyl N-[1-[2-(3,4-dihydroxyphenyl)ethylamino]-1-oxo-3-phenylpropan-2-yl]carbamate (PubChem CID 101239089) has the molecular formula C24H30N2O10 and a molecular weight of 506.51 g/mol. Its IUPAC name is [(2R,3S,4S,5R)-3,4,5,6-tetrahydroxyoxan-2-yl]methyl N-[1-[2-(3,4-dihydroxyphenyl)ethylamino]-1-oxo-3-phenylpropan-2-yl]carbamate.
| Compound Name | [(2R,3S,4S,5R)-3,4,5,6-tetrahydroxyoxan-2-yl]methyl N-[1-[2-(3,4-dihydroxyphenyl)ethylamino]-1-oxo-3-phenylpropan-2-yl]carbamate |
|---|---|
| PubChem CID | 101239089 |
| Molecular Formula | C24H30N2O10 |
| Molecular Weight | 506.51 g/mol |
| Exact Mass | 506.19 |
| IUPAC Name | [(2R,3S,4S,5R)-3,4,5,6-tetrahydroxyoxan-2-yl]methyl N-[1-[2-(3,4-dihydroxyphenyl)ethylamino]-1-oxo-3-phenylpropan-2-yl]carbamate |
| SMILES | O=C(NC(Cc1ccccc1)C(=O)NCCc1ccc(O)c(O)c1)OC[C@H]1OC(O)[C@H](O)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C24H30N2O10/c27-16-7-6-14(11-17(16)28)8-9-25-22(32)15(10-13-4-2-1-3-5-13)26-24(34)35-12-18-19(29)20(30)21(31)23(33)36-18/h1-7,11,15,18-21,23,27-31,33H,8-10,12H2,(H,25,32)(H,26,34)/t15?,18-,19-,20+,21-,23?/m1/s1 |
| InChIKey | YYAIWFUOCIHUQR-FHTAIKAESA-N |
| XLogP | -1.11 |
| TPSA | 198.04 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.51 |
| LogP ≤ 5 | -1.11 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|