C15H21NO9 — CID 11078863
[(2R,3R,4S,5R,6R)-2,3,5-trihydroxy-6-(hydroxymethyl)oxan-4-yl] N-[2-(3,4-dihydroxyphenyl)ethyl]carbamate (PubChem CID 11078863) has the molecular formula C15H21NO9 and a molecular weight of 359.33 g/mol. Its IUPAC name is [(2R,3R,4S,5R,6R)-2,3,5-trihydroxy-6-(hydroxymethyl)oxan-4-yl] N-[2-(3,4-dihydroxyphenyl)ethyl]carbamate.
| Compound Name | [(2R,3R,4S,5R,6R)-2,3,5-trihydroxy-6-(hydroxymethyl)oxan-4-yl] N-[2-(3,4-dihydroxyphenyl)ethyl]carbamate |
|---|---|
| PubChem CID | 11078863 |
| Molecular Formula | C15H21NO9 |
| Molecular Weight | 359.33 g/mol |
| Exact Mass | 359.12 |
| IUPAC Name | [(2R,3R,4S,5R,6R)-2,3,5-trihydroxy-6-(hydroxymethyl)oxan-4-yl] N-[2-(3,4-dihydroxyphenyl)ethyl]carbamate |
| SMILES | O=C(NCCc1ccc(O)c(O)c1)O[C@@H]1[C@@H](O)[C@H](O)O[C@H](CO)[C@H]1O |
| InChI | InChI=1S/C15H21NO9/c17-6-10-11(20)13(12(21)14(22)24-10)25-15(23)16-4-3-7-1-2-8(18)9(19)5-7/h1-2,5,10-14,17-22H,3-4,6H2,(H,16,23)/t10-,11-,12-,13+,14-/m1/s1 |
| InChIKey | JREHHIKFOJHBSR-XGFWRYKXSA-N |
| XLogP | -1.83 |
| TPSA | 168.94 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.33 |
| LogP ≤ 5 | -1.83 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|