C20H26O9 — CID 162940044
[2-[3-(3,4-dihydroxyphenyl)prop-1-enoxy]-3,5-dihydroxy-6-(hydroxymethyl)oxan-4-yl] 3-methylbut-2-enoate (PubChem CID 162940044) has the molecular formula C20H26O9 and a molecular weight of 410.42 g/mol. Its IUPAC name is [2-[3-(3,4-dihydroxyphenyl)prop-1-enoxy]-3,5-dihydroxy-6-(hydroxymethyl)oxan-4-yl] 3-methylbut-2-enoate.
| Compound Name | [2-[3-(3,4-dihydroxyphenyl)prop-1-enoxy]-3,5-dihydroxy-6-(hydroxymethyl)oxan-4-yl] 3-methylbut-2-enoate |
|---|---|
| PubChem CID | 162940044 |
| Molecular Formula | C20H26O9 |
| Molecular Weight | 410.42 g/mol |
| Exact Mass | 410.16 |
| IUPAC Name | [2-[3-(3,4-dihydroxyphenyl)prop-1-enoxy]-3,5-dihydroxy-6-(hydroxymethyl)oxan-4-yl] 3-methylbut-2-enoate |
| SMILES | CC(C)=CC(=O)OC1C(O)C(CO)OC(OC=CCc2ccc(O)c(O)c2)C1O |
| InChI | InChI=1S/C20H26O9/c1-11(2)8-16(24)29-19-17(25)15(10-21)28-20(18(19)26)27-7-3-4-12-5-6-13(22)14(23)9-12/h3,5-9,15,17-23,25-26H,4,10H2,1-2H3 |
| InChIKey | POFNIOAWPQMQDC-UHFFFAOYSA-N |
| XLogP | 0.49 |
| TPSA | 145.91 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.42 |
| LogP ≤ 5 | 0.49 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|