C24H28O11 — CID 163185231
[(2S,3R,4S,5S,6R)-2-[2-(3,4-dihydroxyphenyl)ethoxy]-4,5-dihydroxy-6-(hydroxymethyl)oxan-3-yl] (E)-3-(4-hydroxy-3-methoxyphenyl)prop-2-enoate (PubChem CID 163185231) has the molecular formula C24H28O11 and a molecular weight of 492.48 g/mol. Its IUPAC name is [(2S,3R,4S,5S,6R)-2-[2-(3,4-dihydroxyphenyl)ethoxy]-4,5-dihydroxy-6-(hydroxymethyl)oxan-3-yl] (E)-3-(4-hydroxy-3-methoxyphenyl)prop-2-enoate.
| Compound Name | [(2S,3R,4S,5S,6R)-2-[2-(3,4-dihydroxyphenyl)ethoxy]-4,5-dihydroxy-6-(hydroxymethyl)oxan-3-yl] (E)-3-(4-hydroxy-3-methoxyphenyl)prop-2-enoate |
|---|---|
| PubChem CID | 163185231 |
| Molecular Formula | C24H28O11 |
| Molecular Weight | 492.48 g/mol |
| Exact Mass | 492.16 |
| IUPAC Name | [(2S,3R,4S,5S,6R)-2-[2-(3,4-dihydroxyphenyl)ethoxy]-4,5-dihydroxy-6-(hydroxymethyl)oxan-3-yl] (E)-3-(4-hydroxy-3-methoxyphenyl)prop-2-enoate |
| SMILES | COc1cc(/C=C/C(=O)O[C@H]2[C@@H](OCCc3ccc(O)c(O)c3)O[C@H](CO)[C@@H](O)[C@@H]2O)ccc1O |
| InChI | InChI=1S/C24H28O11/c1-32-18-11-13(3-6-16(18)27)4-7-20(29)35-23-22(31)21(30)19(12-25)34-24(23)33-9-8-14-2-5-15(26)17(28)10-14/h2-7,10-11,19,21-28,30-31H,8-9,12H2,1H3/b7-4+/t19-,21-,22+,23-,24+/m1/s1 |
| InChIKey | CELUHKZRIDESEX-PTBXJHAKSA-N |
| XLogP | 0.44 |
| TPSA | 175.37 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.48 |
| LogP ≤ 5 | 0.44 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|