C29H36O16 — CID 85220255
[2-[2-(3,4-dihydroxyphenyl)ethoxy]-4,5-dihydroxy-6-[[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxymethyl]oxan-3-yl] 3-(3,4-dihydroxyphenyl)prop-2-enoate (PubChem CID 85220255) has the molecular formula C29H36O16 and a molecular weight of 640.59 g/mol. Its IUPAC name is [2-[2-(3,4-dihydroxyphenyl)ethoxy]-4,5-dihydroxy-6-[[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxymethyl]oxan-3-yl] 3-(3,4-dihydroxyphenyl)prop-2-enoate.
| Compound Name | [2-[2-(3,4-dihydroxyphenyl)ethoxy]-4,5-dihydroxy-6-[[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxymethyl]oxan-3-yl] 3-(3,4-dihydroxyphenyl)prop-2-enoate |
|---|---|
| PubChem CID | 85220255 |
| Molecular Formula | C29H36O16 |
| Molecular Weight | 640.59 g/mol |
| Exact Mass | 640.20 |
| IUPAC Name | [2-[2-(3,4-dihydroxyphenyl)ethoxy]-4,5-dihydroxy-6-[[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxymethyl]oxan-3-yl] 3-(3,4-dihydroxyphenyl)prop-2-enoate |
| SMILES | O=C(C=Cc1ccc(O)c(O)c1)OC1C(OCCc2ccc(O)c(O)c2)OC(COC2OC(CO)C(O)C(O)C2O)C(O)C1O |
| InChI | InChI=1S/C29H36O16/c30-11-19-22(36)24(38)26(40)28(43-19)42-12-20-23(37)25(39)27(45-21(35)6-3-13-1-4-15(31)17(33)9-13)29(44-20)41-8-7-14-2-5-16(32)18(34)10-14/h1-6,9-10,19-20,22-34,36-40H,7-8,11-12H2 |
| InChIKey | FHPIQLCBJIIFCH-UHFFFAOYSA-N |
| XLogP | -2.04 |
| TPSA | 265.52 Ų |
| H-Bond Donors | 10 |
| H-Bond Acceptors | 16 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 45 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 640.59 |
| LogP ≤ 5 | -2.04 |
| H-Bond Donors ≤ 5 | 10 |
| H-Bond Acceptors ≤ 10 | 16 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|