C33H30O15 — CID 86566504
[(2R,3R,4R,5R,6S)-4,6-bis[[(E)-3-(3,4-dihydroxyphenyl)prop-2-enoyl]oxy]-5-hydroxy-2-(hydroxymethyl)oxan-3-yl] (E)-3-(3,4-dihydroxyphenyl)prop-2-enoate (PubChem CID 86566504) has the molecular formula C33H30O15 and a molecular weight of 666.59 g/mol. Its IUPAC name is [(2R,3R,4R,5R,6S)-4,6-bis[[(E)-3-(3,4-dihydroxyphenyl)prop-2-enoyl]oxy]-5-hydroxy-2-(hydroxymethyl)oxan-3-yl] (E)-3-(3,4-dihydroxyphenyl)prop-2-enoate.
| Compound Name | [(2R,3R,4R,5R,6S)-4,6-bis[[(E)-3-(3,4-dihydroxyphenyl)prop-2-enoyl]oxy]-5-hydroxy-2-(hydroxymethyl)oxan-3-yl] (E)-3-(3,4-dihydroxyphenyl)prop-2-enoate |
|---|---|
| PubChem CID | 86566504 |
| Molecular Formula | C33H30O15 |
| Molecular Weight | 666.59 g/mol |
| Exact Mass | 666.16 |
| IUPAC Name | [(2R,3R,4R,5R,6S)-4,6-bis[[(E)-3-(3,4-dihydroxyphenyl)prop-2-enoyl]oxy]-5-hydroxy-2-(hydroxymethyl)oxan-3-yl] (E)-3-(3,4-dihydroxyphenyl)prop-2-enoate |
| SMILES | O=C(/C=C/c1ccc(O)c(O)c1)O[C@@H]1O[C@H](CO)[C@@H](OC(=O)/C=C/c2ccc(O)c(O)c2)[C@H](OC(=O)/C=C/c2ccc(O)c(O)c2)[C@H]1O |
| InChI | InChI=1S/C33H30O15/c34-16-26-31(46-27(41)10-4-17-1-7-20(35)23(38)13-17)32(47-28(42)11-5-18-2-8-21(36)24(39)14-18)30(44)33(45-26)48-29(43)12-6-19-3-9-22(37)25(40)15-19/h1-15,26,30-40,44H,16H2/b10-4+,11-5+,12-6+/t26-,30-,31-,32-,33+/m1/s1 |
| InChIKey | GQBVJURCVRERBF-BQVMYESRSA-N |
| XLogP | 1.81 |
| TPSA | 249.97 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 48 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 666.59 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|