C21H28O10 — CID 162884631
[(2R,3S,4S,5S,6R)-4,5-dihydroxy-2-[(1S,2S)-2-hydroxycyclohexyl]oxy-6-(hydroxymethyl)oxan-3-yl] 3-(3,4-dihydroxyphenyl)prop-2-enoate (PubChem CID 162884631) has the molecular formula C21H28O10 and a molecular weight of 440.45 g/mol. Its IUPAC name is [(2R,3S,4S,5S,6R)-4,5-dihydroxy-2-[(1S,2S)-2-hydroxycyclohexyl]oxy-6-(hydroxymethyl)oxan-3-yl] 3-(3,4-dihydroxyphenyl)prop-2-enoate.
| Compound Name | [(2R,3S,4S,5S,6R)-4,5-dihydroxy-2-[(1S,2S)-2-hydroxycyclohexyl]oxy-6-(hydroxymethyl)oxan-3-yl] 3-(3,4-dihydroxyphenyl)prop-2-enoate |
|---|---|
| PubChem CID | 162884631 |
| Molecular Formula | C21H28O10 |
| Molecular Weight | 440.45 g/mol |
| Exact Mass | 440.17 |
| IUPAC Name | [(2R,3S,4S,5S,6R)-4,5-dihydroxy-2-[(1S,2S)-2-hydroxycyclohexyl]oxy-6-(hydroxymethyl)oxan-3-yl] 3-(3,4-dihydroxyphenyl)prop-2-enoate |
| SMILES | O=C(C=Cc1ccc(O)c(O)c1)O[C@@H]1[C@H](O[C@H]2CCCC[C@@H]2O)O[C@H](CO)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C21H28O10/c22-10-16-18(27)19(28)20(21(30-16)29-15-4-2-1-3-13(15)24)31-17(26)8-6-11-5-7-12(23)14(25)9-11/h5-9,13,15-16,18-25,27-28H,1-4,10H2/t13-,15-,16+,18+,19-,20-,21+/m0/s1 |
| InChIKey | GYBMMZYCUFIKJQ-BJGPJROUSA-N |
| XLogP | -0.22 |
| TPSA | 166.14 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.45 |
| LogP ≤ 5 | -0.22 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|