C28H34O15 — CID 85430439
[6-[2-(3,4-dihydroxyphenyl)ethoxy]-5-hydroxy-2-(hydroxymethyl)-4-(3,4,5-trihydroxyoxan-2-yl)oxyoxan-3-yl] 3-(3,4-dihydroxyphenyl)prop-2-enoate (PubChem CID 85430439) has the molecular formula C28H34O15 and a molecular weight of 610.57 g/mol. Its IUPAC name is [6-[2-(3,4-dihydroxyphenyl)ethoxy]-5-hydroxy-2-(hydroxymethyl)-4-(3,4,5-trihydroxyoxan-2-yl)oxyoxan-3-yl] 3-(3,4-dihydroxyphenyl)prop-2-enoate.
| Compound Name | [6-[2-(3,4-dihydroxyphenyl)ethoxy]-5-hydroxy-2-(hydroxymethyl)-4-(3,4,5-trihydroxyoxan-2-yl)oxyoxan-3-yl] 3-(3,4-dihydroxyphenyl)prop-2-enoate |
|---|---|
| PubChem CID | 85430439 |
| Molecular Formula | C28H34O15 |
| Molecular Weight | 610.57 g/mol |
| Exact Mass | 610.19 |
| IUPAC Name | [6-[2-(3,4-dihydroxyphenyl)ethoxy]-5-hydroxy-2-(hydroxymethyl)-4-(3,4,5-trihydroxyoxan-2-yl)oxyoxan-3-yl] 3-(3,4-dihydroxyphenyl)prop-2-enoate |
| SMILES | O=C(C=Cc1ccc(O)c(O)c1)OC1C(CO)OC(OCCc2ccc(O)c(O)c2)C(O)C1OC1OCC(O)C(O)C1O |
| InChI | InChI=1S/C28H34O15/c29-11-20-25(42-21(35)6-3-13-1-4-15(30)17(32)9-13)26(43-27-23(37)22(36)19(34)12-40-27)24(38)28(41-20)39-8-7-14-2-5-16(31)18(33)10-14/h1-6,9-10,19-20,22-34,36-38H,7-8,11-12H2 |
| InChIKey | IIVINXPOHZUXQM-UHFFFAOYSA-N |
| XLogP | -1.40 |
| TPSA | 245.29 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 43 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 610.57 |
| LogP ≤ 5 | -1.40 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|