C22H22O13 — CID 73077078
[2-[3-(3,4-dihydroxyphenyl)prop-2-enoyloxy]-3,5-dihydroxy-6-(hydroxymethyl)oxan-4-yl] 3,4,5-trihydroxybenzoate (PubChem CID 73077078) has the molecular formula C22H22O13 and a molecular weight of 494.41 g/mol. Its IUPAC name is [2-[3-(3,4-dihydroxyphenyl)prop-2-enoyloxy]-3,5-dihydroxy-6-(hydroxymethyl)oxan-4-yl] 3,4,5-trihydroxybenzoate.
| Compound Name | [2-[3-(3,4-dihydroxyphenyl)prop-2-enoyloxy]-3,5-dihydroxy-6-(hydroxymethyl)oxan-4-yl] 3,4,5-trihydroxybenzoate |
|---|---|
| PubChem CID | 73077078 |
| Molecular Formula | C22H22O13 |
| Molecular Weight | 494.41 g/mol |
| Exact Mass | 494.11 |
| IUPAC Name | [2-[3-(3,4-dihydroxyphenyl)prop-2-enoyloxy]-3,5-dihydroxy-6-(hydroxymethyl)oxan-4-yl] 3,4,5-trihydroxybenzoate |
| SMILES | O=C(C=Cc1ccc(O)c(O)c1)OC1OC(CO)C(O)C(OC(=O)c2cc(O)c(O)c(O)c2)C1O |
| InChI | InChI=1S/C22H22O13/c23-8-15-18(30)20(35-21(32)10-6-13(26)17(29)14(27)7-10)19(31)22(33-15)34-16(28)4-2-9-1-3-11(24)12(25)5-9/h1-7,15,18-20,22-27,29-31H,8H2 |
| InChIKey | SBBBRSIXPCDQAG-UHFFFAOYSA-N |
| XLogP | -0.56 |
| TPSA | 223.67 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.41 |
| LogP ≤ 5 | -0.56 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|