C27H32O13 — CID 163049849
[(2R,3R,4S,5R,6R)-5-[2-(3,4-dihydroxyphenyl)acetyl]oxy-3-hydroxy-2-(hydroxymethyl)-6-(4-hydroxy-2-methylbut-2-enoxy)oxan-4-yl] 2-(3,4-dihydroxyphenyl)acetate (PubChem CID 163049849) has the molecular formula C27H32O13 and a molecular weight of 564.54 g/mol. Its IUPAC name is [(2R,3R,4S,5R,6R)-5-[2-(3,4-dihydroxyphenyl)acetyl]oxy-3-hydroxy-2-(hydroxymethyl)-6-(4-hydroxy-2-methylbut-2-enoxy)oxan-4-yl] 2-(3,4-dihydroxyphenyl)acetate.
| Compound Name | [(2R,3R,4S,5R,6R)-5-[2-(3,4-dihydroxyphenyl)acetyl]oxy-3-hydroxy-2-(hydroxymethyl)-6-(4-hydroxy-2-methylbut-2-enoxy)oxan-4-yl] 2-(3,4-dihydroxyphenyl)acetate |
|---|---|
| PubChem CID | 163049849 |
| Molecular Formula | C27H32O13 |
| Molecular Weight | 564.54 g/mol |
| Exact Mass | 564.18 |
| IUPAC Name | [(2R,3R,4S,5R,6R)-5-[2-(3,4-dihydroxyphenyl)acetyl]oxy-3-hydroxy-2-(hydroxymethyl)-6-(4-hydroxy-2-methylbut-2-enoxy)oxan-4-yl] 2-(3,4-dihydroxyphenyl)acetate |
| SMILES | CC(=CCO)CO[C@@H]1O[C@H](CO)[C@@H](O)[C@H](OC(=O)Cc2ccc(O)c(O)c2)[C@H]1OC(=O)Cc1ccc(O)c(O)c1 |
| InChI | InChI=1S/C27H32O13/c1-14(6-7-28)13-37-27-26(40-23(35)11-16-3-5-18(31)20(33)9-16)25(24(36)21(12-29)38-27)39-22(34)10-15-2-4-17(30)19(32)8-15/h2-6,8-9,21,24-33,36H,7,10-13H2,1H3/t21-,24-,25+,26-,27-/m1/s1 |
| InChIKey | ADDKDISNWQJHTB-BYBMWWPSSA-N |
| XLogP | 0.15 |
| TPSA | 212.67 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.54 |
| LogP ≤ 5 | 0.15 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|