C24H32O10 — CID 175066207
[(2R,3R,4S,5R,6R)-3-acetyloxy-2-[2-[3,4-bis(prop-2-enoxy)phenyl]ethoxy]-5-hydroxy-6-(hydroxymethyl)oxan-4-yl] acetate (PubChem CID 175066207) has the molecular formula C24H32O10 and a molecular weight of 480.51 g/mol. Its IUPAC name is [(2R,3R,4S,5R,6R)-3-acetyloxy-2-[2-[3,4-bis(prop-2-enoxy)phenyl]ethoxy]-5-hydroxy-6-(hydroxymethyl)oxan-4-yl] acetate.
| Compound Name | [(2R,3R,4S,5R,6R)-3-acetyloxy-2-[2-[3,4-bis(prop-2-enoxy)phenyl]ethoxy]-5-hydroxy-6-(hydroxymethyl)oxan-4-yl] acetate |
|---|---|
| PubChem CID | 175066207 |
| Molecular Formula | C24H32O10 |
| Molecular Weight | 480.51 g/mol |
| Exact Mass | 480.20 |
| IUPAC Name | [(2R,3R,4S,5R,6R)-3-acetyloxy-2-[2-[3,4-bis(prop-2-enoxy)phenyl]ethoxy]-5-hydroxy-6-(hydroxymethyl)oxan-4-yl] acetate |
| SMILES | C=CCOc1ccc(CCO[C@@H]2O[C@H](CO)[C@@H](O)[C@H](OC(C)=O)[C@H]2OC(C)=O)cc1OCC=C |
| InChI | InChI=1S/C24H32O10/c1-5-10-29-18-8-7-17(13-19(18)30-11-6-2)9-12-31-24-23(33-16(4)27)22(32-15(3)26)21(28)20(14-25)34-24/h5-8,13,20-25,28H,1-2,9-12,14H2,3-4H3/t20-,21-,22+,23-,24-/m1/s1 |
| InChIKey | RGWIIDXCXCHHBO-GNADVCDUSA-N |
| XLogP | 1.32 |
| TPSA | 129.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.51 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|