C37H42O11 — CID 10556322
[(2R,3R,4S,5R,6R)-3,5-diacetyloxy-6-[2-[3,4-bis(phenylmethoxy)phenyl]ethoxy]-4-prop-2-enoxyoxan-2-yl]methyl acetate (PubChem CID 10556322) has the molecular formula C37H42O11 and a molecular weight of 662.73 g/mol. Its IUPAC name is [(2R,3R,4S,5R,6R)-3,5-diacetyloxy-6-[2-[3,4-bis(phenylmethoxy)phenyl]ethoxy]-4-prop-2-enoxyoxan-2-yl]methyl acetate.
| Compound Name | [(2R,3R,4S,5R,6R)-3,5-diacetyloxy-6-[2-[3,4-bis(phenylmethoxy)phenyl]ethoxy]-4-prop-2-enoxyoxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 10556322 |
| Molecular Formula | C37H42O11 |
| Molecular Weight | 662.73 g/mol |
| Exact Mass | 662.27 |
| IUPAC Name | [(2R,3R,4S,5R,6R)-3,5-diacetyloxy-6-[2-[3,4-bis(phenylmethoxy)phenyl]ethoxy]-4-prop-2-enoxyoxan-2-yl]methyl acetate |
| SMILES | C=CCO[C@@H]1[C@@H](OC(C)=O)[C@H](OCCc2ccc(OCc3ccccc3)c(OCc3ccccc3)c2)O[C@H](COC(C)=O)[C@H]1OC(C)=O |
| InChI | InChI=1S/C37H42O11/c1-5-19-41-35-34(46-26(3)39)33(24-43-25(2)38)48-37(36(35)47-27(4)40)42-20-18-28-16-17-31(44-22-29-12-8-6-9-13-29)32(21-28)45-23-30-14-10-7-11-15-30/h5-17,21,33-37H,1,18-20,22-24H2,2-4H3/t33-,34-,35+,36-,37-/m1/s1 |
| InChIKey | VXJKRUDEBQPELS-KHKVHWIZSA-N |
| XLogP | 5.13 |
| TPSA | 125.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 48 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 662.73 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|