C27H30O11 — CID 14837931
[(2R,3R,4S,5R,6S)-3,4,5-triacetyloxy-6-(4-phenylmethoxyphenoxy)oxan-2-yl]methyl acetate (PubChem CID 14837931) has the molecular formula C27H30O11 and a molecular weight of 530.53 g/mol. Its IUPAC name is [(2R,3R,4S,5R,6S)-3,4,5-triacetyloxy-6-(4-phenylmethoxyphenoxy)oxan-2-yl]methyl acetate.
| Compound Name | [(2R,3R,4S,5R,6S)-3,4,5-triacetyloxy-6-(4-phenylmethoxyphenoxy)oxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 14837931 |
| Molecular Formula | C27H30O11 |
| Molecular Weight | 530.53 g/mol |
| Exact Mass | 530.18 |
| IUPAC Name | [(2R,3R,4S,5R,6S)-3,4,5-triacetyloxy-6-(4-phenylmethoxyphenoxy)oxan-2-yl]methyl acetate |
| SMILES | CC(=O)OC[C@H]1O[C@@H](Oc2ccc(OCc3ccccc3)cc2)[C@H](OC(C)=O)[C@@H](OC(C)=O)[C@@H]1OC(C)=O |
| InChI | InChI=1S/C27H30O11/c1-16(28)32-15-23-24(34-17(2)29)25(35-18(3)30)26(36-19(4)31)27(38-23)37-22-12-10-21(11-13-22)33-14-20-8-6-5-7-9-20/h5-13,23-27H,14-15H2,1-4H3/t23-,24-,25+,26-,27-/m1/s1 |
| InChIKey | HAYYMZQBNFHYBU-IURCNINISA-N |
| XLogP | 2.73 |
| TPSA | 132.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.53 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|