C34H36O11 — CID 90741032
[(2R,3R,4S,5R)-3,4,5-triacetyloxy-6-[2-[(4-phenylmethoxyphenyl)methyl]phenoxy]oxan-2-yl]methyl acetate (PubChem CID 90741032) has the molecular formula C34H36O11 and a molecular weight of 620.65 g/mol. Its IUPAC name is [(2R,3R,4S,5R)-3,4,5-triacetyloxy-6-[2-[(4-phenylmethoxyphenyl)methyl]phenoxy]oxan-2-yl]methyl acetate.
| Compound Name | [(2R,3R,4S,5R)-3,4,5-triacetyloxy-6-[2-[(4-phenylmethoxyphenyl)methyl]phenoxy]oxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 90741032 |
| Molecular Formula | C34H36O11 |
| Molecular Weight | 620.65 g/mol |
| Exact Mass | 620.23 |
| IUPAC Name | [(2R,3R,4S,5R)-3,4,5-triacetyloxy-6-[2-[(4-phenylmethoxyphenyl)methyl]phenoxy]oxan-2-yl]methyl acetate |
| SMILES | CC(=O)OC[C@H]1OC(Oc2ccccc2Cc2ccc(OCc3ccccc3)cc2)[C@H](OC(C)=O)[C@@H](OC(C)=O)[C@@H]1OC(C)=O |
| InChI | InChI=1S/C34H36O11/c1-21(35)39-20-30-31(41-22(2)36)32(42-23(3)37)33(43-24(4)38)34(45-30)44-29-13-9-8-12-27(29)18-25-14-16-28(17-15-25)40-19-26-10-6-5-7-11-26/h5-17,30-34H,18-20H2,1-4H3/t30-,31-,32+,33-,34?/m1/s1 |
| InChIKey | LQYBLIGFLSVJQN-BKJHVTENSA-N |
| XLogP | 4.32 |
| TPSA | 132.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 620.65 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|