C28H31NO11 — CID 68875323
[(2R,3R,4S,5R,6R)-3,4,5-triacetyloxy-6-[2-[(4-carbamoylphenyl)methyl]phenoxy]oxan-2-yl]methyl acetate (PubChem CID 68875323) has the molecular formula C28H31NO11 and a molecular weight of 557.55 g/mol. Its IUPAC name is [(2R,3R,4S,5R,6R)-3,4,5-triacetyloxy-6-[2-[(4-carbamoylphenyl)methyl]phenoxy]oxan-2-yl]methyl acetate.
| Compound Name | [(2R,3R,4S,5R,6R)-3,4,5-triacetyloxy-6-[2-[(4-carbamoylphenyl)methyl]phenoxy]oxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 68875323 |
| Molecular Formula | C28H31NO11 |
| Molecular Weight | 557.55 g/mol |
| Exact Mass | 557.19 |
| IUPAC Name | [(2R,3R,4S,5R,6R)-3,4,5-triacetyloxy-6-[2-[(4-carbamoylphenyl)methyl]phenoxy]oxan-2-yl]methyl acetate |
| SMILES | CC(=O)OC[C@H]1O[C@H](Oc2ccccc2Cc2ccc(C(N)=O)cc2)[C@H](OC(C)=O)[C@@H](OC(C)=O)[C@@H]1OC(C)=O |
| InChI | InChI=1S/C28H31NO11/c1-15(30)35-14-23-24(36-16(2)31)25(37-17(3)32)26(38-18(4)33)28(40-23)39-22-8-6-5-7-21(22)13-19-9-11-20(12-10-19)27(29)34/h5-12,23-26,28H,13-14H2,1-4H3,(H2,29,34)/t23-,24-,25+,26-,28+/m1/s1 |
| InChIKey | BHDUUPJLYODWOV-CBNWRBMVSA-N |
| XLogP | 1.84 |
| TPSA | 166.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.55 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|