C31H38O10 — CID 91573304
[(2R,3R,4S,5R)-3,4,5-triacetyloxy-6-[2-[[4-(2-methylpropyl)phenyl]methyl]phenoxy]oxan-2-yl]methyl acetate (PubChem CID 91573304) has the molecular formula C31H38O10 and a molecular weight of 570.64 g/mol. Its IUPAC name is [(2R,3R,4S,5R)-3,4,5-triacetyloxy-6-[2-[[4-(2-methylpropyl)phenyl]methyl]phenoxy]oxan-2-yl]methyl acetate.
| Compound Name | [(2R,3R,4S,5R)-3,4,5-triacetyloxy-6-[2-[[4-(2-methylpropyl)phenyl]methyl]phenoxy]oxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 91573304 |
| Molecular Formula | C31H38O10 |
| Molecular Weight | 570.64 g/mol |
| Exact Mass | 570.25 |
| IUPAC Name | [(2R,3R,4S,5R)-3,4,5-triacetyloxy-6-[2-[[4-(2-methylpropyl)phenyl]methyl]phenoxy]oxan-2-yl]methyl acetate |
| SMILES | CC(=O)OC[C@H]1OC(Oc2ccccc2Cc2ccc(CC(C)C)cc2)[C@H](OC(C)=O)[C@@H](OC(C)=O)[C@@H]1OC(C)=O |
| InChI | InChI=1S/C31H38O10/c1-18(2)15-23-11-13-24(14-12-23)16-25-9-7-8-10-26(25)40-31-30(39-22(6)35)29(38-21(5)34)28(37-20(4)33)27(41-31)17-36-19(3)32/h7-14,18,27-31H,15-17H2,1-6H3/t27-,28-,29+,30-,31?/m1/s1 |
| InChIKey | FOOLUSPXOKZHCU-JCLUOYIWSA-N |
| XLogP | 3.94 |
| TPSA | 123.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.64 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|