C22H31NO8 — CID 167150918
[(2R,3R,4R,5R,6S)-3,4-diacetyloxy-5-amino-6-[4-(2-methylpropyl)phenoxy]oxan-2-yl]methyl acetate (PubChem CID 167150918) has the molecular formula C22H31NO8 and a molecular weight of 437.49 g/mol. Its IUPAC name is [(2R,3R,4R,5R,6S)-3,4-diacetyloxy-5-amino-6-[4-(2-methylpropyl)phenoxy]oxan-2-yl]methyl acetate.
| Compound Name | [(2R,3R,4R,5R,6S)-3,4-diacetyloxy-5-amino-6-[4-(2-methylpropyl)phenoxy]oxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 167150918 |
| Molecular Formula | C22H31NO8 |
| Molecular Weight | 437.49 g/mol |
| Exact Mass | 437.20 |
| IUPAC Name | [(2R,3R,4R,5R,6S)-3,4-diacetyloxy-5-amino-6-[4-(2-methylpropyl)phenoxy]oxan-2-yl]methyl acetate |
| SMILES | CC(=O)OC[C@H]1O[C@@H](Oc2ccc(CC(C)C)cc2)[C@H](N)[C@@H](OC(C)=O)[C@H]1OC(C)=O |
| InChI | InChI=1S/C22H31NO8/c1-12(2)10-16-6-8-17(9-7-16)30-22-19(23)21(29-15(5)26)20(28-14(4)25)18(31-22)11-27-13(3)24/h6-9,12,18-22H,10-11,23H2,1-5H3/t18-,19-,20+,21-,22-/m1/s1 |
| InChIKey | BLQOFDNMKITFSN-QMCAAQAGSA-N |
| XLogP | 1.74 |
| TPSA | 123.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.49 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|