C17H31NO8Si — CID 10894766
[(2R,3S,4R,5R,6R)-3,4-diacetyloxy-5-amino-6-(2-trimethylsilylethoxy)oxan-2-yl]methyl acetate (PubChem CID 10894766) has the molecular formula C17H31NO8Si and a molecular weight of 405.52 g/mol. Its IUPAC name is [(2R,3S,4R,5R,6R)-3,4-diacetyloxy-5-amino-6-(2-trimethylsilylethoxy)oxan-2-yl]methyl acetate.
| Compound Name | [(2R,3S,4R,5R,6R)-3,4-diacetyloxy-5-amino-6-(2-trimethylsilylethoxy)oxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 10894766 |
| Molecular Formula | C17H31NO8Si |
| Molecular Weight | 405.52 g/mol |
| Exact Mass | 405.18 |
| IUPAC Name | [(2R,3S,4R,5R,6R)-3,4-diacetyloxy-5-amino-6-(2-trimethylsilylethoxy)oxan-2-yl]methyl acetate |
| SMILES | CC(=O)OC[C@H]1O[C@@H](OCC[Si](C)(C)C)[C@H](N)[C@@H](OC(C)=O)[C@@H]1OC(C)=O |
| InChI | InChI=1S/C17H31NO8Si/c1-10(19)23-9-13-15(24-11(2)20)16(25-12(3)21)14(18)17(26-13)22-7-8-27(4,5)6/h13-17H,7-9,18H2,1-6H3/t13-,14-,15-,16-,17-/m1/s1 |
| InChIKey | SQUQBXUYVAZCQG-WRQOLXDDSA-N |
| XLogP | 0.82 |
| TPSA | 123.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.52 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|