C13H19ClO8 — CID 101089484
[(2R,3R,4S,5S)-3,4-diacetyloxy-5-(2-chloroethoxy)oxolan-2-yl]methyl acetate (PubChem CID 101089484) has the molecular formula C13H19ClO8 and a molecular weight of 338.74 g/mol. Its IUPAC name is [(2R,3R,4S,5S)-3,4-diacetyloxy-5-(2-chloroethoxy)oxolan-2-yl]methyl acetate.
| Compound Name | [(2R,3R,4S,5S)-3,4-diacetyloxy-5-(2-chloroethoxy)oxolan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 101089484 |
| Molecular Formula | C13H19ClO8 |
| Molecular Weight | 338.74 g/mol |
| Exact Mass | 338.08 |
| IUPAC Name | [(2R,3R,4S,5S)-3,4-diacetyloxy-5-(2-chloroethoxy)oxolan-2-yl]methyl acetate |
| SMILES | CC(=O)OC[C@H]1O[C@H](OCCCl)[C@@H](OC(C)=O)[C@@H]1OC(C)=O |
| InChI | InChI=1S/C13H19ClO8/c1-7(15)19-6-10-11(20-8(2)16)12(21-9(3)17)13(22-10)18-5-4-14/h10-13H,4-6H2,1-3H3/t10-,11-,12+,13+/m1/s1 |
| InChIKey | KDIXGYMKYBHWBF-NDBYEHHHSA-N |
| XLogP | 0.39 |
| TPSA | 97.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.74 |
| LogP ≤ 5 | 0.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|