C18H29ClO11 — CID 91364859
[(2R,3R,4S,5R,6S)-3,5-diacetyloxy-6-[2-[2-(2-chloroethoxy)ethoxy]ethoxy]-4-hydroxyoxan-2-yl]methyl acetate (PubChem CID 91364859) has the molecular formula C18H29ClO11 and a molecular weight of 456.87 g/mol. Its IUPAC name is [(2R,3R,4S,5R,6S)-3,5-diacetyloxy-6-[2-[2-(2-chloroethoxy)ethoxy]ethoxy]-4-hydroxyoxan-2-yl]methyl acetate.
| Compound Name | [(2R,3R,4S,5R,6S)-3,5-diacetyloxy-6-[2-[2-(2-chloroethoxy)ethoxy]ethoxy]-4-hydroxyoxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 91364859 |
| Molecular Formula | C18H29ClO11 |
| Molecular Weight | 456.87 g/mol |
| Exact Mass | 456.14 |
| IUPAC Name | [(2R,3R,4S,5R,6S)-3,5-diacetyloxy-6-[2-[2-(2-chloroethoxy)ethoxy]ethoxy]-4-hydroxyoxan-2-yl]methyl acetate |
| SMILES | CC(=O)OC[C@H]1O[C@H](OCCOCCOCCCl)[C@H](OC(C)=O)[C@@H](O)[C@H]1OC(C)=O |
| InChI | InChI=1S/C18H29ClO11/c1-11(20)27-10-14-16(28-12(2)21)15(23)17(29-13(3)22)18(30-14)26-9-8-25-7-6-24-5-4-19/h14-18,23H,4-10H2,1-3H3/t14-,15+,16+,17-,18+/m1/s1 |
| InChIKey | IRTZSNGFIONMSD-ICUGJSFKSA-N |
| XLogP | -0.21 |
| TPSA | 136.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.87 |
| LogP ≤ 5 | -0.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|