C18H32O8 — CID 101206625
[(2R,3S,4S,5S,6S)-5-acetyloxy-3,4-dihydroxy-6-octoxyoxan-2-yl]methyl acetate (PubChem CID 101206625) has the molecular formula C18H32O8 and a molecular weight of 376.45 g/mol. Its IUPAC name is [(2R,3S,4S,5S,6S)-5-acetyloxy-3,4-dihydroxy-6-octoxyoxan-2-yl]methyl acetate.
| Compound Name | [(2R,3S,4S,5S,6S)-5-acetyloxy-3,4-dihydroxy-6-octoxyoxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 101206625 |
| Molecular Formula | C18H32O8 |
| Molecular Weight | 376.45 g/mol |
| Exact Mass | 376.21 |
| IUPAC Name | [(2R,3S,4S,5S,6S)-5-acetyloxy-3,4-dihydroxy-6-octoxyoxan-2-yl]methyl acetate |
| SMILES | CCCCCCCCO[C@H]1O[C@H](COC(C)=O)[C@@H](O)[C@H](O)[C@@H]1OC(C)=O |
| InChI | InChI=1S/C18H32O8/c1-4-5-6-7-8-9-10-23-18-17(25-13(3)20)16(22)15(21)14(26-18)11-24-12(2)19/h14-18,21-22H,4-11H2,1-3H3/t14-,15-,16+,17+,18+/m1/s1 |
| InChIKey | RISQFDKCWPIRLF-ZBRFXRBCSA-N |
| XLogP | 1.30 |
| TPSA | 111.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.45 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|