C19H31NO10 — CID 101189145
[(2R,3S,4S,5R,6R)-3,4,5-triacetyloxy-6-(5-aminopentoxy)oxan-2-yl]methyl acetate (PubChem CID 101189145) has the molecular formula C19H31NO10 and a molecular weight of 433.45 g/mol. Its IUPAC name is [(2R,3S,4S,5R,6R)-3,4,5-triacetyloxy-6-(5-aminopentoxy)oxan-2-yl]methyl acetate.
| Compound Name | [(2R,3S,4S,5R,6R)-3,4,5-triacetyloxy-6-(5-aminopentoxy)oxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 101189145 |
| Molecular Formula | C19H31NO10 |
| Molecular Weight | 433.45 g/mol |
| Exact Mass | 433.19 |
| IUPAC Name | [(2R,3S,4S,5R,6R)-3,4,5-triacetyloxy-6-(5-aminopentoxy)oxan-2-yl]methyl acetate |
| SMILES | CC(=O)OC[C@H]1O[C@@H](OCCCCCN)[C@H](OC(C)=O)[C@@H](OC(C)=O)[C@H]1OC(C)=O |
| InChI | InChI=1S/C19H31NO10/c1-11(21)26-10-15-16(27-12(2)22)17(28-13(3)23)18(29-14(4)24)19(30-15)25-9-7-5-6-8-20/h15-19H,5-10,20H2,1-4H3/t15-,16+,17+,18-,19-/m1/s1 |
| InChIKey | BARKWBSVHKRYOS-ICBNADEASA-N |
| XLogP | 0.22 |
| TPSA | 149.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.45 |
| LogP ≤ 5 | 0.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|