C24H40O10 — CID 11060024
[(2R,3S,4S,5R,6R)-3,4,5-triacetyloxy-6-decoxyoxan-2-yl]methyl acetate (PubChem CID 11060024) has the molecular formula C24H40O10 and a molecular weight of 488.57 g/mol. Its IUPAC name is [(2R,3S,4S,5R,6R)-3,4,5-triacetyloxy-6-decoxyoxan-2-yl]methyl acetate.
| Compound Name | [(2R,3S,4S,5R,6R)-3,4,5-triacetyloxy-6-decoxyoxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 11060024 |
| Molecular Formula | C24H40O10 |
| Molecular Weight | 488.57 g/mol |
| Exact Mass | 488.26 |
| IUPAC Name | [(2R,3S,4S,5R,6R)-3,4,5-triacetyloxy-6-decoxyoxan-2-yl]methyl acetate |
| SMILES | CCCCCCCCCCO[C@@H]1O[C@H](COC(C)=O)[C@H](OC(C)=O)[C@H](OC(C)=O)[C@H]1OC(C)=O |
| InChI | InChI=1S/C24H40O10/c1-6-7-8-9-10-11-12-13-14-29-24-23(33-19(5)28)22(32-18(4)27)21(31-17(3)26)20(34-24)15-30-16(2)25/h20-24H,6-15H2,1-5H3/t20-,21+,22+,23-,24-/m1/s1 |
| InChIKey | VEQLMKYUFBTODC-OYTPZHDJSA-N |
| XLogP | 3.23 |
| TPSA | 123.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.57 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|