C25H46O8 — CID 91723132
[(2R,3R,4S,5S,6S)-4-acetyloxy-3,5-diheptoxy-6-methoxyoxan-2-yl]methyl acetate (PubChem CID 91723132) has the molecular formula C25H46O8 and a molecular weight of 474.64 g/mol. Its IUPAC name is [(2R,3R,4S,5S,6S)-4-acetyloxy-3,5-diheptoxy-6-methoxyoxan-2-yl]methyl acetate.
| Compound Name | [(2R,3R,4S,5S,6S)-4-acetyloxy-3,5-diheptoxy-6-methoxyoxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 91723132 |
| Molecular Formula | C25H46O8 |
| Molecular Weight | 474.64 g/mol |
| Exact Mass | 474.32 |
| IUPAC Name | [(2R,3R,4S,5S,6S)-4-acetyloxy-3,5-diheptoxy-6-methoxyoxan-2-yl]methyl acetate |
| SMILES | CCCCCCCO[C@@H]1[C@@H](OC)O[C@H](COC(C)=O)[C@@H](OCCCCCCC)[C@@H]1OC(C)=O |
| InChI | InChI=1S/C25H46O8/c1-6-8-10-12-14-16-29-22-21(18-31-19(3)26)33-25(28-5)24(23(22)32-20(4)27)30-17-15-13-11-9-7-2/h21-25H,6-18H2,1-5H3/t21-,22-,23+,24+,25+/m1/s1 |
| InChIKey | CDSGOWSRRIVCEJ-VAFBSOEGSA-N |
| XLogP | 4.56 |
| TPSA | 89.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.64 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|