C17H28O9 — CID 123724883
(3,4-diacetyloxy-5-hydroxy-6-pentoxyoxan-2-yl)methyl acetate (PubChem CID 123724883) has the molecular formula C17H28O9 and a molecular weight of 376.40 g/mol. Its IUPAC name is (3,4-diacetyloxy-5-hydroxy-6-pentoxyoxan-2-yl)methyl acetate.
| Compound Name | (3,4-diacetyloxy-5-hydroxy-6-pentoxyoxan-2-yl)methyl acetate |
|---|---|
| PubChem CID | 123724883 |
| Molecular Formula | C17H28O9 |
| Molecular Weight | 376.40 g/mol |
| Exact Mass | 376.17 |
| IUPAC Name | (3,4-diacetyloxy-5-hydroxy-6-pentoxyoxan-2-yl)methyl acetate |
| SMILES | CCCCCOC1OC(COC(C)=O)C(OC(C)=O)C(OC(C)=O)C1O |
| InChI | InChI=1S/C17H28O9/c1-5-6-7-8-22-17-14(21)16(25-12(4)20)15(24-11(3)19)13(26-17)9-23-10(2)18/h13-17,21H,5-9H2,1-4H3 |
| InChIKey | HLHDUDKFXMKGQS-UHFFFAOYSA-N |
| XLogP | 0.71 |
| TPSA | 117.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.40 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|