C20H32O11 — CID 12003172
[(2R,3R,4S,5R,6R)-3,4,5-triacetyloxy-6-(5-hydroxyhexoxy)oxan-2-yl]methyl acetate (PubChem CID 12003172) has the molecular formula C20H32O11 and a molecular weight of 448.47 g/mol. Its IUPAC name is [(2R,3R,4S,5R,6R)-3,4,5-triacetyloxy-6-(5-hydroxyhexoxy)oxan-2-yl]methyl acetate.
| Compound Name | [(2R,3R,4S,5R,6R)-3,4,5-triacetyloxy-6-(5-hydroxyhexoxy)oxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 12003172 |
| Molecular Formula | C20H32O11 |
| Molecular Weight | 448.47 g/mol |
| Exact Mass | 448.19 |
| IUPAC Name | [(2R,3R,4S,5R,6R)-3,4,5-triacetyloxy-6-(5-hydroxyhexoxy)oxan-2-yl]methyl acetate |
| SMILES | CC(=O)OC[C@H]1O[C@@H](OCCCCC(C)O)[C@H](OC(C)=O)[C@@H](OC(C)=O)[C@@H]1OC(C)=O |
| InChI | InChI=1S/C20H32O11/c1-11(21)8-6-7-9-26-20-19(30-15(5)25)18(29-14(4)24)17(28-13(3)23)16(31-20)10-27-12(2)22/h11,16-21H,6-10H2,1-5H3/t11?,16-,17-,18+,19-,20-/m1/s1 |
| InChIKey | IEXVGJNYTBKEHG-TWSSRQJUSA-N |
| XLogP | 0.64 |
| TPSA | 143.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.47 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|