C17H26O13 — CID 91858455
[(2S,3S,4R,5R)-3,4-diacetyloxy-5-[[(2R,3S,4S,5R)-3,4,5,6-tetrahydroxyoxan-2-yl]methoxy]oxolan-2-yl]methyl acetate (PubChem CID 91858455) has the molecular formula C17H26O13 and a molecular weight of 438.38 g/mol. Its IUPAC name is [(2S,3S,4R,5R)-3,4-diacetyloxy-5-[[(2R,3S,4S,5R)-3,4,5,6-tetrahydroxyoxan-2-yl]methoxy]oxolan-2-yl]methyl acetate.
| Compound Name | [(2S,3S,4R,5R)-3,4-diacetyloxy-5-[[(2R,3S,4S,5R)-3,4,5,6-tetrahydroxyoxan-2-yl]methoxy]oxolan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 91858455 |
| Molecular Formula | C17H26O13 |
| Molecular Weight | 438.38 g/mol |
| Exact Mass | 438.14 |
| IUPAC Name | [(2S,3S,4R,5R)-3,4-diacetyloxy-5-[[(2R,3S,4S,5R)-3,4,5,6-tetrahydroxyoxan-2-yl]methoxy]oxolan-2-yl]methyl acetate |
| SMILES | CC(=O)OC[C@@H]1O[C@@H](OC[C@H]2OC(O)[C@H](O)[C@@H](O)[C@@H]2O)[C@H](OC(C)=O)[C@H]1OC(C)=O |
| InChI | InChI=1S/C17H26O13/c1-6(18)25-5-10-14(27-7(2)19)15(28-8(3)20)17(30-10)26-4-9-11(21)12(22)13(23)16(24)29-9/h9-17,21-24H,4-5H2,1-3H3/t9-,10+,11-,12+,13-,14+,15-,16?,17-/m1/s1 |
| InChIKey | FQBXMWOEWLUFKG-IEQCBPPLSA-N |
| XLogP | -3.05 |
| TPSA | 187.51 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.38 |
| LogP ≤ 5 | -3.05 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|