C19H31ClNO10+ — CID 146629317
chloromethyl-dimethyl-[2-[(2S,3S,4R,5S,6S)-3,4,5-triacetyloxy-6-(acetyloxymethyl)oxan-2-yl]oxyethyl]azanium (PubChem CID 146629317) has the molecular formula C19H31ClNO10+ and a molecular weight of 468.91 g/mol. Its IUPAC name is chloromethyl-dimethyl-[2-[(2S,3S,4R,5S,6S)-3,4,5-triacetyloxy-6-(acetyloxymethyl)oxan-2-yl]oxyethyl]azanium.
| Compound Name | chloromethyl-dimethyl-[2-[(2S,3S,4R,5S,6S)-3,4,5-triacetyloxy-6-(acetyloxymethyl)oxan-2-yl]oxyethyl]azanium |
|---|---|
| PubChem CID | 146629317 |
| Molecular Formula | C19H31ClNO10+ |
| Molecular Weight | 468.91 g/mol |
| Exact Mass | 468.16 |
| IUPAC Name | chloromethyl-dimethyl-[2-[(2S,3S,4R,5S,6S)-3,4,5-triacetyloxy-6-(acetyloxymethyl)oxan-2-yl]oxyethyl]azanium |
| SMILES | CC(=O)OC[C@@H]1O[C@H](OCC[N+](C)(C)CCl)[C@@H](OC(C)=O)[C@H](OC(C)=O)[C@H]1OC(C)=O |
| InChI | InChI=1S/C19H31ClNO10/c1-11(22)27-9-15-16(28-12(2)23)17(29-13(3)24)18(30-14(4)25)19(31-15)26-8-7-21(5,6)10-20/h15-19H,7-10H2,1-6H3/q+1/t15-,16-,17+,18-,19-/m0/s1 |
| InChIKey | DTFYLTHLEGONOO-OYSTVDSJSA-N |
| XLogP | 0.36 |
| TPSA | 123.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.91 |
| LogP ≤ 5 | 0.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|