C20H34NO10+ — CID 163726542
ethyl-dimethyl-[2-[(2R,3R,4S,5R,6R)-3,4,5-triacetyloxy-6-(acetyloxymethyl)oxan-2-yl]oxyethyl]azanium (PubChem CID 163726542) has the molecular formula C20H34NO10+ and a molecular weight of 448.49 g/mol. Its IUPAC name is ethyl-dimethyl-[2-[(2R,3R,4S,5R,6R)-3,4,5-triacetyloxy-6-(acetyloxymethyl)oxan-2-yl]oxyethyl]azanium.
| Compound Name | ethyl-dimethyl-[2-[(2R,3R,4S,5R,6R)-3,4,5-triacetyloxy-6-(acetyloxymethyl)oxan-2-yl]oxyethyl]azanium |
|---|---|
| PubChem CID | 163726542 |
| Molecular Formula | C20H34NO10+ |
| Molecular Weight | 448.49 g/mol |
| Exact Mass | 448.22 |
| IUPAC Name | ethyl-dimethyl-[2-[(2R,3R,4S,5R,6R)-3,4,5-triacetyloxy-6-(acetyloxymethyl)oxan-2-yl]oxyethyl]azanium |
| SMILES | CC[N+](C)(C)CCO[C@@H]1O[C@H](COC(C)=O)[C@@H](OC(C)=O)[C@H](OC(C)=O)[C@H]1OC(C)=O |
| InChI | InChI=1S/C20H34NO10/c1-8-21(6,7)9-10-26-20-19(30-15(5)25)18(29-14(4)24)17(28-13(3)23)16(31-20)11-27-12(2)22/h16-20H,8-11H2,1-7H3/q+1/t16-,17-,18+,19-,20-/m1/s1 |
| InChIKey | XYHKRMNQCGOBIR-OUUBHVDSSA-N |
| XLogP | 0.18 |
| TPSA | 123.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.49 |
| LogP ≤ 5 | 0.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|