C21H32NO10+ — CID 146629266
dimethyl-prop-2-ynyl-[2-[(3R,4S,5R,6R)-3,4,5-triacetyloxy-6-(acetyloxymethyl)oxan-2-yl]oxyethyl]azanium (PubChem CID 146629266) has the molecular formula C21H32NO10+ and a molecular weight of 458.48 g/mol. Its IUPAC name is dimethyl-prop-2-ynyl-[2-[(3R,4S,5R,6R)-3,4,5-triacetyloxy-6-(acetyloxymethyl)oxan-2-yl]oxyethyl]azanium.
| Compound Name | dimethyl-prop-2-ynyl-[2-[(3R,4S,5R,6R)-3,4,5-triacetyloxy-6-(acetyloxymethyl)oxan-2-yl]oxyethyl]azanium |
|---|---|
| PubChem CID | 146629266 |
| Molecular Formula | C21H32NO10+ |
| Molecular Weight | 458.48 g/mol |
| Exact Mass | 458.20 |
| IUPAC Name | dimethyl-prop-2-ynyl-[2-[(3R,4S,5R,6R)-3,4,5-triacetyloxy-6-(acetyloxymethyl)oxan-2-yl]oxyethyl]azanium |
| SMILES | C#CC[N+](C)(C)CCOC1O[C@H](COC(C)=O)[C@@H](OC(C)=O)[C@H](OC(C)=O)[C@H]1OC(C)=O |
| InChI | InChI=1S/C21H32NO10/c1-8-9-22(6,7)10-11-27-21-20(31-16(5)26)19(30-15(4)25)18(29-14(3)24)17(32-21)12-28-13(2)23/h1,17-21H,9-12H2,2-7H3/q+1/t17-,18-,19+,20-,21?/m1/s1 |
| InChIKey | PVQWEILBBOKCEK-AWGDKMGJSA-N |
| XLogP | -0.20 |
| TPSA | 123.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.48 |
| LogP ≤ 5 | -0.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|