C23H34NO13+ — CID 163530311
acetic acid;dimethyl-[2-oxo-2-[(2S,3R,4S,5R,6R)-3,4,5-triacetyloxy-6-(acetyloxymethyl)oxan-2-yl]oxyethyl]-prop-2-ynylazanium (PubChem CID 163530311) has the molecular formula C23H34NO13+ and a molecular weight of 532.52 g/mol. Its IUPAC name is acetic acid;dimethyl-[2-oxo-2-[(2S,3R,4S,5R,6R)-3,4,5-triacetyloxy-6-(acetyloxymethyl)oxan-2-yl]oxyethyl]-prop-2-ynylazanium.
| Compound Name | acetic acid;dimethyl-[2-oxo-2-[(2S,3R,4S,5R,6R)-3,4,5-triacetyloxy-6-(acetyloxymethyl)oxan-2-yl]oxyethyl]-prop-2-ynylazanium |
|---|---|
| PubChem CID | 163530311 |
| Molecular Formula | C23H34NO13+ |
| Molecular Weight | 532.52 g/mol |
| Exact Mass | 532.20 |
| IUPAC Name | acetic acid;dimethyl-[2-oxo-2-[(2S,3R,4S,5R,6R)-3,4,5-triacetyloxy-6-(acetyloxymethyl)oxan-2-yl]oxyethyl]-prop-2-ynylazanium |
| SMILES | C#CC[N+](C)(C)CC(=O)O[C@@H]1O[C@H](COC(C)=O)[C@@H](OC(C)=O)[C@H](OC(C)=O)[C@H]1OC(C)=O.CC(=O)O |
| InChI | InChI=1S/C21H30NO11.C2H4O2/c1-8-9-22(6,7)10-17(27)33-21-20(31-15(5)26)19(30-14(4)25)18(29-13(3)24)16(32-21)11-28-12(2)23;1-2(3)4/h1,16,18-21H,9-11H2,2-7H3;1H3,(H,3,4)/q+1;/t16-,18-,19+,20-,21+;/m1./s1 |
| InChIKey | QQJVZGOZQPRHCP-ICVQRMELSA-N |
| XLogP | -0.59 |
| TPSA | 178.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.52 |
| LogP ≤ 5 | -0.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|