C23H34NO11+ — CID 146629276
dimethyl-[4-oxo-4-[(3R,4S,5R,6R)-3,4,5-triacetyloxy-6-(acetyloxymethyl)oxan-2-yl]oxybutyl]-prop-2-ynylazanium (PubChem CID 146629276) has the molecular formula C23H34NO11+ and a molecular weight of 500.52 g/mol. Its IUPAC name is dimethyl-[4-oxo-4-[(3R,4S,5R,6R)-3,4,5-triacetyloxy-6-(acetyloxymethyl)oxan-2-yl]oxybutyl]-prop-2-ynylazanium.
| Compound Name | dimethyl-[4-oxo-4-[(3R,4S,5R,6R)-3,4,5-triacetyloxy-6-(acetyloxymethyl)oxan-2-yl]oxybutyl]-prop-2-ynylazanium |
|---|---|
| PubChem CID | 146629276 |
| Molecular Formula | C23H34NO11+ |
| Molecular Weight | 500.52 g/mol |
| Exact Mass | 500.21 |
| IUPAC Name | dimethyl-[4-oxo-4-[(3R,4S,5R,6R)-3,4,5-triacetyloxy-6-(acetyloxymethyl)oxan-2-yl]oxybutyl]-prop-2-ynylazanium |
| SMILES | C#CC[N+](C)(C)CCCC(=O)OC1O[C@H](COC(C)=O)[C@@H](OC(C)=O)[C@H](OC(C)=O)[C@H]1OC(C)=O |
| InChI | InChI=1S/C23H34NO11/c1-8-11-24(6,7)12-9-10-19(29)35-23-22(33-17(5)28)21(32-16(4)27)20(31-15(3)26)18(34-23)13-30-14(2)25/h1,18,20-23H,9-13H2,2-7H3/q+1/t18-,20-,21+,22-,23?/m1/s1 |
| InChIKey | RSXCYZOYYFFXGE-HZKCKKNMSA-N |
| XLogP | 0.10 |
| TPSA | 140.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.52 |
| LogP ≤ 5 | 0.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|