C21H33N2O9+ — CID 146629501
2-[(2R,3R,4R,5S,6R)-3-acetamido-4,5-diacetyloxy-6-(acetyloxymethyl)oxan-2-yl]oxyethyl-dimethyl-prop-2-ynylazanium (PubChem CID 146629501) has the molecular formula C21H33N2O9+ and a molecular weight of 457.50 g/mol. Its IUPAC name is 2-[(2R,3R,4R,5S,6R)-3-acetamido-4,5-diacetyloxy-6-(acetyloxymethyl)oxan-2-yl]oxyethyl-dimethyl-prop-2-ynylazanium.
| Compound Name | 2-[(2R,3R,4R,5S,6R)-3-acetamido-4,5-diacetyloxy-6-(acetyloxymethyl)oxan-2-yl]oxyethyl-dimethyl-prop-2-ynylazanium |
|---|---|
| PubChem CID | 146629501 |
| Molecular Formula | C21H33N2O9+ |
| Molecular Weight | 457.50 g/mol |
| Exact Mass | 457.22 |
| IUPAC Name | 2-[(2R,3R,4R,5S,6R)-3-acetamido-4,5-diacetyloxy-6-(acetyloxymethyl)oxan-2-yl]oxyethyl-dimethyl-prop-2-ynylazanium |
| SMILES | C#CC[N+](C)(C)CCO[C@@H]1O[C@H](COC(C)=O)[C@@H](OC(C)=O)[C@H](OC(C)=O)[C@H]1NC(C)=O |
| InChI | InChI=1S/C21H32N2O9/c1-8-9-23(6,7)10-11-28-21-18(22-13(2)24)20(31-16(5)27)19(30-15(4)26)17(32-21)12-29-14(3)25/h1,17-21H,9-12H2,2-7H3/p+1/t17-,18-,19-,20-,21-/m1/s1 |
| InChIKey | ZBWPGGCGDVSVAG-PFAUGDHASA-O |
| XLogP | -0.63 |
| TPSA | 126.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.50 |
| LogP ≤ 5 | -0.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|