C18H29NO10 — CID 163952927
[5-acetamido-3,4-diacetyloxy-6-(2-ethoxyethoxy)oxan-2-yl]methyl acetate (PubChem CID 163952927) has the molecular formula C18H29NO10 and a molecular weight of 419.43 g/mol. Its IUPAC name is [5-acetamido-3,4-diacetyloxy-6-(2-ethoxyethoxy)oxan-2-yl]methyl acetate.
| Compound Name | [5-acetamido-3,4-diacetyloxy-6-(2-ethoxyethoxy)oxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 163952927 |
| Molecular Formula | C18H29NO10 |
| Molecular Weight | 419.43 g/mol |
| Exact Mass | 419.18 |
| IUPAC Name | [5-acetamido-3,4-diacetyloxy-6-(2-ethoxyethoxy)oxan-2-yl]methyl acetate |
| SMILES | CCOCCOC1OC(COC(C)=O)C(OC(C)=O)C(OC(C)=O)C1NC(C)=O |
| InChI | InChI=1S/C18H29NO10/c1-6-24-7-8-25-18-15(19-10(2)20)17(28-13(5)23)16(27-12(4)22)14(29-18)9-26-11(3)21/h14-18H,6-9H2,1-5H3,(H,19,20) |
| InChIKey | SAWYQXHMJMGHEG-UHFFFAOYSA-N |
| XLogP | -0.30 |
| TPSA | 135.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.43 |
| LogP ≤ 5 | -0.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|