C21H33NO13 — CID 166544567
3-[2-[2-[(5R)-3-acetamido-4,5-diacetyloxy-6-(acetyloxymethyl)oxan-2-yl]oxyethoxy]ethoxy]propanoic acid (PubChem CID 166544567) has the molecular formula C21H33NO13 and a molecular weight of 507.49 g/mol. Its IUPAC name is 3-[2-[2-[(5R)-3-acetamido-4,5-diacetyloxy-6-(acetyloxymethyl)oxan-2-yl]oxyethoxy]ethoxy]propanoic acid.
| Compound Name | 3-[2-[2-[(5R)-3-acetamido-4,5-diacetyloxy-6-(acetyloxymethyl)oxan-2-yl]oxyethoxy]ethoxy]propanoic acid |
|---|---|
| PubChem CID | 166544567 |
| Molecular Formula | C21H33NO13 |
| Molecular Weight | 507.49 g/mol |
| Exact Mass | 507.20 |
| IUPAC Name | 3-[2-[2-[(5R)-3-acetamido-4,5-diacetyloxy-6-(acetyloxymethyl)oxan-2-yl]oxyethoxy]ethoxy]propanoic acid |
| SMILES | CC(=O)NC1C(OCCOCCOCCC(=O)O)OC(COC(C)=O)[C@H](OC(C)=O)C1OC(C)=O |
| InChI | InChI=1S/C21H33NO13/c1-12(23)22-18-20(34-15(4)26)19(33-14(3)25)16(11-32-13(2)24)35-21(18)31-10-9-30-8-7-29-6-5-17(27)28/h16,18-21H,5-11H2,1-4H3,(H,22,23)(H,27,28)/t16?,18?,19-,20?,21?/m0/s1 |
| InChIKey | BFECAIABTAWLPT-IOEFIQEOSA-N |
| XLogP | -0.83 |
| TPSA | 182.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.49 |
| LogP ≤ 5 | -0.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|