C18H28N4O10 — CID 51355476
[(2R,3R,4R,5R,6R)-5-acetamido-3,4-diacetyloxy-6-[2-(2-azidoethoxy)ethoxy]oxan-2-yl]methyl acetate (PubChem CID 51355476) has the molecular formula C18H28N4O10 and a molecular weight of 460.44 g/mol. Its IUPAC name is [(2R,3R,4R,5R,6R)-5-acetamido-3,4-diacetyloxy-6-[2-(2-azidoethoxy)ethoxy]oxan-2-yl]methyl acetate.
| Compound Name | [(2R,3R,4R,5R,6R)-5-acetamido-3,4-diacetyloxy-6-[2-(2-azidoethoxy)ethoxy]oxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 51355476 |
| Molecular Formula | C18H28N4O10 |
| Molecular Weight | 460.44 g/mol |
| Exact Mass | 460.18 |
| IUPAC Name | [(2R,3R,4R,5R,6R)-5-acetamido-3,4-diacetyloxy-6-[2-(2-azidoethoxy)ethoxy]oxan-2-yl]methyl acetate |
| SMILES | CC(=O)N[C@H]1[C@H](OCCOCCN=[N+]=[N-])O[C@H](COC(C)=O)[C@H](OC(C)=O)[C@@H]1OC(C)=O |
| InChI | InChI=1S/C18H28N4O10/c1-10(23)21-15-17(31-13(4)26)16(30-12(3)25)14(9-29-11(2)24)32-18(15)28-8-7-27-6-5-20-22-19/h14-18H,5-9H2,1-4H3,(H,21,23)/t14-,15-,16+,17-,18-/m1/s1 |
| InChIKey | RYGROQIXTIVQGJ-UYTYNIKBSA-N |
| XLogP | -0.01 |
| TPSA | 184.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.44 |
| LogP ≤ 5 | -0.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|