C18H31N3O8 — CID 129122125
[5-acetyloxy-6-[2-[2-(2-azidoethoxy)ethoxy]ethoxy]-3,4-dimethyloxan-2-yl]methyl acetate (PubChem CID 129122125) has the molecular formula C18H31N3O8 and a molecular weight of 417.46 g/mol. Its IUPAC name is [5-acetyloxy-6-[2-[2-(2-azidoethoxy)ethoxy]ethoxy]-3,4-dimethyloxan-2-yl]methyl acetate.
| Compound Name | [5-acetyloxy-6-[2-[2-(2-azidoethoxy)ethoxy]ethoxy]-3,4-dimethyloxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 129122125 |
| Molecular Formula | C18H31N3O8 |
| Molecular Weight | 417.46 g/mol |
| Exact Mass | 417.21 |
| IUPAC Name | [5-acetyloxy-6-[2-[2-(2-azidoethoxy)ethoxy]ethoxy]-3,4-dimethyloxan-2-yl]methyl acetate |
| SMILES | CC(=O)OCC1OC(OCCOCCOCCN=[N+]=[N-])C(OC(C)=O)C(C)C1C |
| InChI | InChI=1S/C18H31N3O8/c1-12-13(2)17(28-15(4)23)18(29-16(12)11-27-14(3)22)26-10-9-25-8-7-24-6-5-20-21-19/h12-13,16-18H,5-11H2,1-4H3 |
| InChIKey | ICJOLTAXGBMYRL-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 138.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.46 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|