C22H33N3O6 — CID 90245346
[(3S,5R,6S)-6-[2-[2-(2-azidoethoxy)ethoxy]ethoxy]-3,4,5-trimethyloxan-2-yl]methyl benzoate (PubChem CID 90245346) has the molecular formula C22H33N3O6 and a molecular weight of 435.52 g/mol. Its IUPAC name is [(3S,5R,6S)-6-[2-[2-(2-azidoethoxy)ethoxy]ethoxy]-3,4,5-trimethyloxan-2-yl]methyl benzoate.
| Compound Name | [(3S,5R,6S)-6-[2-[2-(2-azidoethoxy)ethoxy]ethoxy]-3,4,5-trimethyloxan-2-yl]methyl benzoate |
|---|---|
| PubChem CID | 90245346 |
| Molecular Formula | C22H33N3O6 |
| Molecular Weight | 435.52 g/mol |
| Exact Mass | 435.24 |
| IUPAC Name | [(3S,5R,6S)-6-[2-[2-(2-azidoethoxy)ethoxy]ethoxy]-3,4,5-trimethyloxan-2-yl]methyl benzoate |
| SMILES | CC1[C@H](C)C(COC(=O)c2ccccc2)O[C@H](OCCOCCOCCN=[N+]=[N-])[C@@H]1C |
| InChI | InChI=1S/C22H33N3O6/c1-16-17(2)20(15-30-21(26)19-7-5-4-6-8-19)31-22(18(16)3)29-14-13-28-12-11-27-10-9-24-25-23/h4-8,16-18,20,22H,9-15H2,1-3H3/t16?,17-,18+,20?,22-/m0/s1 |
| InChIKey | JGNHTMUURHNJHM-ABKQVVRKSA-N |
| XLogP | 3.84 |
| TPSA | 111.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.52 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|