C40H39N2O12- — CID 140539836
2-[2-[2-[(2S,4S,5R)-3,4,5-tribenzoyloxy-6-(benzoyloxymethyl)oxan-2-yl]oxyethoxy]ethoxy]ethyliminoazanide (PubChem CID 140539836) has the molecular formula C40H39N2O12- and a molecular weight of 739.75 g/mol. Its IUPAC name is 2-[2-[2-[(2S,4S,5R)-3,4,5-tribenzoyloxy-6-(benzoyloxymethyl)oxan-2-yl]oxyethoxy]ethoxy]ethyliminoazanide.
| Compound Name | 2-[2-[2-[(2S,4S,5R)-3,4,5-tribenzoyloxy-6-(benzoyloxymethyl)oxan-2-yl]oxyethoxy]ethoxy]ethyliminoazanide |
|---|---|
| PubChem CID | 140539836 |
| Molecular Formula | C40H39N2O12- |
| Molecular Weight | 739.75 g/mol |
| Exact Mass | 739.25 |
| IUPAC Name | 2-[2-[2-[(2S,4S,5R)-3,4,5-tribenzoyloxy-6-(benzoyloxymethyl)oxan-2-yl]oxyethoxy]ethoxy]ethyliminoazanide |
| SMILES | [N-]=NCCOCCOCCO[C@H]1OC(COC(=O)c2ccccc2)[C@@H](OC(=O)c2ccccc2)[C@H](OC(=O)c2ccccc2)C1OC(=O)c1ccccc1 |
| InChI | InChI=1S/C40H39N2O12/c41-42-21-22-47-23-24-48-25-26-49-40-35(54-39(46)31-19-11-4-12-20-31)34(53-38(45)30-17-9-3-10-18-30)33(52-37(44)29-15-7-2-8-16-29)32(51-40)27-50-36(43)28-13-5-1-6-14-28/h1-20,32-35,40H,21-27H2/q-1/t32?,33-,34+,35?,40+/m1/s1 |
| InChIKey | OEUWQRYLWLYQKM-ZLEBCRFXSA-N |
| XLogP | 5.32 |
| TPSA | 176.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 54 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 739.75 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|