C41H34O10S — CID 138981394
[(3R,6R)-3,4,5-tribenzoyloxy-6-(phenylsulfanylmethoxy)oxan-2-yl]methyl benzoate (PubChem CID 138981394) has the molecular formula C41H34O10S and a molecular weight of 718.78 g/mol. Its IUPAC name is [(3R,6R)-3,4,5-tribenzoyloxy-6-(phenylsulfanylmethoxy)oxan-2-yl]methyl benzoate.
| Compound Name | [(3R,6R)-3,4,5-tribenzoyloxy-6-(phenylsulfanylmethoxy)oxan-2-yl]methyl benzoate |
|---|---|
| PubChem CID | 138981394 |
| Molecular Formula | C41H34O10S |
| Molecular Weight | 718.78 g/mol |
| Exact Mass | 718.19 |
| IUPAC Name | [(3R,6R)-3,4,5-tribenzoyloxy-6-(phenylsulfanylmethoxy)oxan-2-yl]methyl benzoate |
| SMILES | O=C(OCC1O[C@H](OCSc2ccccc2)C(OC(=O)c2ccccc2)C(OC(=O)c2ccccc2)[C@@H]1OC(=O)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C41H34O10S/c42-37(28-16-6-1-7-17-28)46-26-33-34(49-38(43)29-18-8-2-9-19-29)35(50-39(44)30-20-10-3-11-21-30)36(51-40(45)31-22-12-4-13-23-31)41(48-33)47-27-52-32-24-14-5-15-25-32/h1-25,33-36,41H,26-27H2/t33?,34-,35?,36?,41+/m1/s1 |
| InChIKey | UKQYWRFXVOHKLW-OBLYTTEJSA-N |
| XLogP | 7.01 |
| TPSA | 123.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 52 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 718.78 |
| LogP ≤ 5 | 7.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|