C40H41NO12 — CID 154009227
[(3R,6S)-6-[2-[2-(2-aminoethoxy)ethoxy]ethoxy]-3,4,5-tribenzoyloxyoxan-2-yl]methyl benzoate (PubChem CID 154009227) has the molecular formula C40H41NO12 and a molecular weight of 727.76 g/mol. Its IUPAC name is [(3R,6S)-6-[2-[2-(2-aminoethoxy)ethoxy]ethoxy]-3,4,5-tribenzoyloxyoxan-2-yl]methyl benzoate.
| Compound Name | [(3R,6S)-6-[2-[2-(2-aminoethoxy)ethoxy]ethoxy]-3,4,5-tribenzoyloxyoxan-2-yl]methyl benzoate |
|---|---|
| PubChem CID | 154009227 |
| Molecular Formula | C40H41NO12 |
| Molecular Weight | 727.76 g/mol |
| Exact Mass | 727.26 |
| IUPAC Name | [(3R,6S)-6-[2-[2-(2-aminoethoxy)ethoxy]ethoxy]-3,4,5-tribenzoyloxyoxan-2-yl]methyl benzoate |
| SMILES | NCCOCCOCCO[C@H]1OC(COC(=O)c2ccccc2)[C@@H](OC(=O)c2ccccc2)C(OC(=O)c2ccccc2)C1OC(=O)c1ccccc1 |
| InChI | InChI=1S/C40H41NO12/c41-21-22-46-23-24-47-25-26-48-40-35(53-39(45)31-19-11-4-12-20-31)34(52-38(44)30-17-9-3-10-18-30)33(51-37(43)29-15-7-2-8-16-29)32(50-40)27-49-36(42)28-13-5-1-6-14-28/h1-20,32-35,40H,21-27,41H2/t32?,33-,34?,35?,40+/m1/s1 |
| InChIKey | DCJSMENDQOKZJC-NDIGSVBNSA-N |
| XLogP | 4.25 |
| TPSA | 168.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 727.76 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|