C34H38O9 — CID 165087566
[4,5-dibenzoyloxy-6-(2-butoxyethoxy)-3-methyloxan-2-yl]methyl benzoate (PubChem CID 165087566) has the molecular formula C34H38O9 and a molecular weight of 590.67 g/mol. Its IUPAC name is [4,5-dibenzoyloxy-6-(2-butoxyethoxy)-3-methyloxan-2-yl]methyl benzoate.
| Compound Name | [4,5-dibenzoyloxy-6-(2-butoxyethoxy)-3-methyloxan-2-yl]methyl benzoate |
|---|---|
| PubChem CID | 165087566 |
| Molecular Formula | C34H38O9 |
| Molecular Weight | 590.67 g/mol |
| Exact Mass | 590.25 |
| IUPAC Name | [4,5-dibenzoyloxy-6-(2-butoxyethoxy)-3-methyloxan-2-yl]methyl benzoate |
| SMILES | CCCCOCCOC1OC(COC(=O)c2ccccc2)C(C)C(OC(=O)c2ccccc2)C1OC(=O)c1ccccc1 |
| InChI | InChI=1S/C34H38O9/c1-3-4-20-38-21-22-39-34-30(43-33(37)27-18-12-7-13-19-27)29(42-32(36)26-16-10-6-11-17-26)24(2)28(41-34)23-40-31(35)25-14-8-5-9-15-25/h5-19,24,28-30,34H,3-4,20-23H2,1-2H3 |
| InChIKey | LYFCQPKACRLMFZ-UHFFFAOYSA-N |
| XLogP | 5.49 |
| TPSA | 106.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 590.67 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|