C29H38O7 — CID 70328530
[(6R)-4-benzoyloxy-3,5-dibutoxy-6-methyloxan-2-yl]methyl benzoate (PubChem CID 70328530) has the molecular formula C29H38O7 and a molecular weight of 498.62 g/mol. Its IUPAC name is [(6R)-4-benzoyloxy-3,5-dibutoxy-6-methyloxan-2-yl]methyl benzoate.
| Compound Name | [(6R)-4-benzoyloxy-3,5-dibutoxy-6-methyloxan-2-yl]methyl benzoate |
|---|---|
| PubChem CID | 70328530 |
| Molecular Formula | C29H38O7 |
| Molecular Weight | 498.62 g/mol |
| Exact Mass | 498.26 |
| IUPAC Name | [(6R)-4-benzoyloxy-3,5-dibutoxy-6-methyloxan-2-yl]methyl benzoate |
| SMILES | CCCCOC1C(COC(=O)c2ccccc2)O[C@H](C)C(OCCCC)C1OC(=O)c1ccccc1 |
| InChI | InChI=1S/C29H38O7/c1-4-6-18-32-25-21(3)35-24(20-34-28(30)22-14-10-8-11-15-22)26(33-19-7-5-2)27(25)36-29(31)23-16-12-9-13-17-23/h8-17,21,24-27H,4-7,18-20H2,1-3H3/t21-,24?,25?,26?,27?/m1/s1 |
| InChIKey | NKXBRKPLCUQTMH-OHPUSTGISA-N |
| XLogP | 5.23 |
| TPSA | 80.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.62 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|