C28H25FO7 — CID 163770416
[(2R,3R,4R,5S,6R)-4,5-dibenzoyloxy-3-fluoro-6-methyloxan-2-yl]methyl benzoate (PubChem CID 163770416) has the molecular formula C28H25FO7 and a molecular weight of 492.50 g/mol. Its IUPAC name is [(2R,3R,4R,5S,6R)-4,5-dibenzoyloxy-3-fluoro-6-methyloxan-2-yl]methyl benzoate.
| Compound Name | [(2R,3R,4R,5S,6R)-4,5-dibenzoyloxy-3-fluoro-6-methyloxan-2-yl]methyl benzoate |
|---|---|
| PubChem CID | 163770416 |
| Molecular Formula | C28H25FO7 |
| Molecular Weight | 492.50 g/mol |
| Exact Mass | 492.16 |
| IUPAC Name | [(2R,3R,4R,5S,6R)-4,5-dibenzoyloxy-3-fluoro-6-methyloxan-2-yl]methyl benzoate |
| SMILES | C[C@H]1O[C@H](COC(=O)c2ccccc2)[C@@H](F)[C@H](OC(=O)c2ccccc2)[C@H]1OC(=O)c1ccccc1 |
| InChI | InChI=1S/C28H25FO7/c1-18-24(35-27(31)20-13-7-3-8-14-20)25(36-28(32)21-15-9-4-10-16-21)23(29)22(34-18)17-33-26(30)19-11-5-2-6-12-19/h2-16,18,22-25H,17H2,1H3/t18-,22-,23-,24+,25+/m1/s1 |
| InChIKey | MFXXNKGIHXDSSD-LTWLMLOISA-N |
| XLogP | 4.42 |
| TPSA | 88.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.50 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|