C21H20O8 — CID 70920419
[(2R,5S)-5-acetyloxy-3-benzoyloxy-4-hydroxyoxolan-2-yl]methyl benzoate (PubChem CID 70920419) has the molecular formula C21H20O8 and a molecular weight of 400.38 g/mol. Its IUPAC name is [(2R,5S)-5-acetyloxy-3-benzoyloxy-4-hydroxyoxolan-2-yl]methyl benzoate.
| Compound Name | [(2R,5S)-5-acetyloxy-3-benzoyloxy-4-hydroxyoxolan-2-yl]methyl benzoate |
|---|---|
| PubChem CID | 70920419 |
| Molecular Formula | C21H20O8 |
| Molecular Weight | 400.38 g/mol |
| Exact Mass | 400.12 |
| IUPAC Name | [(2R,5S)-5-acetyloxy-3-benzoyloxy-4-hydroxyoxolan-2-yl]methyl benzoate |
| SMILES | CC(=O)O[C@@H]1O[C@H](COC(=O)c2ccccc2)C(OC(=O)c2ccccc2)C1O |
| InChI | InChI=1S/C21H20O8/c1-13(22)27-21-17(23)18(29-20(25)15-10-6-3-7-11-15)16(28-21)12-26-19(24)14-8-4-2-5-9-14/h2-11,16-18,21,23H,12H2,1H3/t16-,17?,18?,21-/m1/s1 |
| InChIKey | KRMKYXZVYHBMSB-FRVUEHSBSA-N |
| XLogP | 1.72 |
| TPSA | 108.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.38 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|