C14H16O7 — CID 22215551
[(2S,3R,4R,5S)-5-acetyloxy-3,4-dihydroxyoxolan-2-yl]methyl benzoate (PubChem CID 22215551) has the molecular formula C14H16O7 and a molecular weight of 296.27 g/mol. Its IUPAC name is [(2S,3R,4R,5S)-5-acetyloxy-3,4-dihydroxyoxolan-2-yl]methyl benzoate.
| Compound Name | [(2S,3R,4R,5S)-5-acetyloxy-3,4-dihydroxyoxolan-2-yl]methyl benzoate |
|---|---|
| PubChem CID | 22215551 |
| Molecular Formula | C14H16O7 |
| Molecular Weight | 296.27 g/mol |
| Exact Mass | 296.09 |
| IUPAC Name | [(2S,3R,4R,5S)-5-acetyloxy-3,4-dihydroxyoxolan-2-yl]methyl benzoate |
| SMILES | CC(=O)O[C@@H]1O[C@@H](COC(=O)c2ccccc2)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C14H16O7/c1-8(15)20-14-12(17)11(16)10(21-14)7-19-13(18)9-5-3-2-4-6-9/h2-6,10-12,14,16-17H,7H2,1H3/t10-,11-,12+,14+/m0/s1 |
| InChIKey | LCWOLBZGFCYBAG-CIQGVGRVSA-N |
| XLogP | -0.15 |
| TPSA | 102.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.27 |
| LogP ≤ 5 | -0.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |