C17H17F3O7 — CID 10810403
[(2S,3R,4R,5S)-4,5-diacetyloxy-3-(trifluoromethyl)oxolan-2-yl]methyl benzoate (PubChem CID 10810403) has the molecular formula C17H17F3O7 and a molecular weight of 390.31 g/mol. Its IUPAC name is [(2S,3R,4R,5S)-4,5-diacetyloxy-3-(trifluoromethyl)oxolan-2-yl]methyl benzoate.
| Compound Name | [(2S,3R,4R,5S)-4,5-diacetyloxy-3-(trifluoromethyl)oxolan-2-yl]methyl benzoate |
|---|---|
| PubChem CID | 10810403 |
| Molecular Formula | C17H17F3O7 |
| Molecular Weight | 390.31 g/mol |
| Exact Mass | 390.09 |
| IUPAC Name | [(2S,3R,4R,5S)-4,5-diacetyloxy-3-(trifluoromethyl)oxolan-2-yl]methyl benzoate |
| SMILES | CC(=O)O[C@@H]1O[C@H](COC(=O)c2ccccc2)[C@@H](C(F)(F)F)[C@H]1OC(C)=O |
| InChI | InChI=1S/C17H17F3O7/c1-9(21)25-14-13(17(18,19)20)12(27-16(14)26-10(2)22)8-24-15(23)11-6-4-3-5-7-11/h3-7,12-14,16H,8H2,1-2H3/t12-,13-,14-,16-/m1/s1 |
| InChIKey | LPVKUNLGQRYPRM-IXYNUQLISA-N |
| XLogP | 2.24 |
| TPSA | 88.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.31 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|