C29H27NO9 — CID 163702613
(6-acetyloxy-3-amino-4,5-dibenzoyloxyoxan-2-yl)methyl benzoate (PubChem CID 163702613) has the molecular formula C29H27NO9 and a molecular weight of 533.53 g/mol. Its IUPAC name is (6-acetyloxy-3-amino-4,5-dibenzoyloxyoxan-2-yl)methyl benzoate.
| Compound Name | (6-acetyloxy-3-amino-4,5-dibenzoyloxyoxan-2-yl)methyl benzoate |
|---|---|
| PubChem CID | 163702613 |
| Molecular Formula | C29H27NO9 |
| Molecular Weight | 533.53 g/mol |
| Exact Mass | 533.17 |
| IUPAC Name | (6-acetyloxy-3-amino-4,5-dibenzoyloxyoxan-2-yl)methyl benzoate |
| SMILES | CC(=O)OC1OC(COC(=O)c2ccccc2)C(N)C(OC(=O)c2ccccc2)C1OC(=O)c1ccccc1 |
| InChI | InChI=1S/C29H27NO9/c1-18(31)36-29-25(39-28(34)21-15-9-4-10-16-21)24(38-27(33)20-13-7-3-8-14-20)23(30)22(37-29)17-35-26(32)19-11-5-2-6-12-19/h2-16,22-25,29H,17,30H2,1H3 |
| InChIKey | KCIQCWPCWLFCKW-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 140.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.53 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|