C14H18O6 — CID 70844005
[(2R,3S,5S)-3-hydroxy-4,5-dimethoxyoxolan-2-yl]methyl benzoate (PubChem CID 70844005) has the molecular formula C14H18O6 and a molecular weight of 282.29 g/mol. Its IUPAC name is [(2R,3S,5S)-3-hydroxy-4,5-dimethoxyoxolan-2-yl]methyl benzoate.
| Compound Name | [(2R,3S,5S)-3-hydroxy-4,5-dimethoxyoxolan-2-yl]methyl benzoate |
|---|---|
| PubChem CID | 70844005 |
| Molecular Formula | C14H18O6 |
| Molecular Weight | 282.29 g/mol |
| Exact Mass | 282.11 |
| IUPAC Name | [(2R,3S,5S)-3-hydroxy-4,5-dimethoxyoxolan-2-yl]methyl benzoate |
| SMILES | COC1[C@@H](OC)O[C@H](COC(=O)c2ccccc2)[C@@H]1O |
| InChI | InChI=1S/C14H18O6/c1-17-12-11(15)10(20-14(12)18-2)8-19-13(16)9-6-4-3-5-7-9/h3-7,10-12,14-15H,8H2,1-2H3/t10-,11+,12?,14+/m1/s1 |
| InChIKey | DXWROQKFHBSMJU-SOIPSNBUSA-N |
| XLogP | 0.59 |
| TPSA | 74.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.29 |
| LogP ≤ 5 | 0.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |